C11H24N2 — CID 177314597
1-[(Z)-but-2-en-2-yl]-4,5-dihydroimidazole;ethane (PubChem CID 177314597) has the molecular formula C11H24N2 and a molecular weight of 184.33 g/mol. Its IUPAC name is 1-[(Z)-but-2-en-2-yl]-4,5-dihydroimidazole;ethane.
| Compound Name | 1-[(Z)-but-2-en-2-yl]-4,5-dihydroimidazole;ethane |
|---|---|
| PubChem CID | 177314597 |
| Molecular Formula | C11H24N2 |
| Molecular Weight | 184.33 g/mol |
| Exact Mass | 184.19 |
| IUPAC Name | 1-[(Z)-but-2-en-2-yl]-4,5-dihydroimidazole;ethane |
| SMILES | C/C=C(/C)N1C=NCC1.CC.CC |
| InChI | InChI=1S/C7H12N2.2C2H6/c1-3-7(2)9-5-4-8-6-9;2*1-2/h3,6H,4-5H2,1-2H3;2*1-2H3/b7-3-;; |
| InChIKey | UFEPEHCNCJRANI-NAMRTZQUSA-N |
| XLogP | 3.31 |
| TPSA | 15.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 184.33 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |