C23H40N4O6 — CID 177316008
tert-butyl 5-amino-2-(methylamino)-5-oxopentanoate;tert-butyl N-(2-oxoethyl)carbamate;4-methylpyridine (PubChem CID 177316008) has the molecular formula C23H40N4O6 and a molecular weight of 468.60 g/mol. Its IUPAC name is tert-butyl 5-amino-2-(methylamino)-5-oxopentanoate;tert-butyl N-(2-oxoethyl)carbamate;4-methylpyridine.
| Compound Name | tert-butyl 5-amino-2-(methylamino)-5-oxopentanoate;tert-butyl N-(2-oxoethyl)carbamate;4-methylpyridine |
|---|---|
| PubChem CID | 177316008 |
| Molecular Formula | C23H40N4O6 |
| Molecular Weight | 468.60 g/mol |
| Exact Mass | 468.29 |
| IUPAC Name | tert-butyl 5-amino-2-(methylamino)-5-oxopentanoate;tert-butyl N-(2-oxoethyl)carbamate;4-methylpyridine |
| SMILES | CC(C)(C)OC(=O)NCC=O.CNC(CCC(N)=O)C(=O)OC(C)(C)C.Cc1ccncc1 |
| InChI | InChI=1S/C10H20N2O3.C7H13NO3.C6H7N/c1-10(2,3)15-9(14)7(12-4)5-6-8(11)13;1-7(2,3)11-6(10)8-4-5-9;1-6-2-4-7-5-3-6/h7,12H,5-6H2,1-4H3,(H2,11,13);5H,4H2,1-3H3,(H,8,10);2-5H,1H3 |
| InChIKey | XHFJVVUMRXTIOM-UHFFFAOYSA-N |
| XLogP | 2.28 |
| TPSA | 149.71 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.60 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|