C27H50N6O5 — CID 177039172
tert-butyl N-(2-oxoethyl)carbamate;(2S)-5-(carbamoylamino)-N-[4-ethyl-3-(methylaminomethyl)phenyl]-2-(methylamino)pentanamide;propane (PubChem CID 177039172) has the molecular formula C27H50N6O5 and a molecular weight of 538.73 g/mol. Its IUPAC name is tert-butyl N-(2-oxoethyl)carbamate;(2S)-5-(carbamoylamino)-N-[4-ethyl-3-(methylaminomethyl)phenyl]-2-(methylamino)pentanamide;propane.
| Compound Name | tert-butyl N-(2-oxoethyl)carbamate;(2S)-5-(carbamoylamino)-N-[4-ethyl-3-(methylaminomethyl)phenyl]-2-(methylamino)pentanamide;propane |
|---|---|
| PubChem CID | 177039172 |
| Molecular Formula | C27H50N6O5 |
| Molecular Weight | 538.73 g/mol |
| Exact Mass | 538.38 |
| IUPAC Name | tert-butyl N-(2-oxoethyl)carbamate;(2S)-5-(carbamoylamino)-N-[4-ethyl-3-(methylaminomethyl)phenyl]-2-(methylamino)pentanamide;propane |
| SMILES | CC(C)(C)OC(=O)NCC=O.CCC.CCc1ccc(NC(=O)[C@H](CCCNC(N)=O)NC)cc1CNC |
| InChI | InChI=1S/C17H29N5O2.C7H13NO3.C3H8/c1-4-12-7-8-14(10-13(12)11-19-2)22-16(23)15(20-3)6-5-9-21-17(18)24;1-7(2,3)11-6(10)8-4-5-9;1-3-2/h7-8,10,15,19-20H,4-6,9,11H2,1-3H3,(H,22,23)(H3,18,21,24);5H,4H2,1-3H3,(H,8,10);3H2,1-2H3/t15-;;/m0../s1 |
| InChIKey | FAUFYMNLNHEKDC-CKUXDGONSA-N |
| XLogP | 3.07 |
| TPSA | 163.68 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 538.73 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|