C33H51N7O10 — CID 163384804
tert-butyl N-(2-oxoethyl)carbamate;[4-[[5-(carbamoylamino)-2-(methylamino)pentanoyl]amino]-2-(methylaminomethyl)phenyl]methyl (4-nitrophenyl) carbonate;propane (PubChem CID 163384804) has the molecular formula C33H51N7O10 and a molecular weight of 705.81 g/mol. Its IUPAC name is tert-butyl N-(2-oxoethyl)carbamate;[4-[[5-(carbamoylamino)-2-(methylamino)pentanoyl]amino]-2-(methylaminomethyl)phenyl]methyl (4-nitrophenyl) carbonate;propane.
| Compound Name | tert-butyl N-(2-oxoethyl)carbamate;[4-[[5-(carbamoylamino)-2-(methylamino)pentanoyl]amino]-2-(methylaminomethyl)phenyl]methyl (4-nitrophenyl) carbonate;propane |
|---|---|
| PubChem CID | 163384804 |
| Molecular Formula | C33H51N7O10 |
| Molecular Weight | 705.81 g/mol |
| Exact Mass | 705.37 |
| IUPAC Name | tert-butyl N-(2-oxoethyl)carbamate;[4-[[5-(carbamoylamino)-2-(methylamino)pentanoyl]amino]-2-(methylaminomethyl)phenyl]methyl (4-nitrophenyl) carbonate;propane |
| SMILES | CC(C)(C)OC(=O)NCC=O.CCC.CNCc1cc(NC(=O)C(CCCNC(N)=O)NC)ccc1COC(=O)Oc1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C23H30N6O7.C7H13NO3.C3H8/c1-25-13-16-12-17(28-21(30)20(26-2)4-3-11-27-22(24)31)6-5-15(16)14-35-23(32)36-19-9-7-18(8-10-19)29(33)34;1-7(2,3)11-6(10)8-4-5-9;1-3-2/h5-10,12,20,25-26H,3-4,11,13-14H2,1-2H3,(H,28,30)(H3,24,27,31);5H,4H2,1-3H3,(H,8,10);3H2,1-2H3 |
| InChIKey | RXDYINOVUJLVBX-UHFFFAOYSA-N |
| XLogP | 4.13 |
| TPSA | 242.35 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 50 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 705.81 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenyl_carbonate', 'substructure': 'N/A'} |
|---|