C29H32N6O9 — CID 167089118
[4-[[5-(carbamoylamino)-2-(methylamino)pentanoyl]amino]-2-[[prop-2-ynoxycarbonyl(prop-2-ynyl)amino]methyl]phenyl]methyl (4-nitrophenyl) carbonate (PubChem CID 167089118) has the molecular formula C29H32N6O9 and a molecular weight of 608.61 g/mol. Its IUPAC name is [4-[[5-(carbamoylamino)-2-(methylamino)pentanoyl]amino]-2-[[prop-2-ynoxycarbonyl(prop-2-ynyl)amino]methyl]phenyl]methyl (4-nitrophenyl) carbonate.
| Compound Name | [4-[[5-(carbamoylamino)-2-(methylamino)pentanoyl]amino]-2-[[prop-2-ynoxycarbonyl(prop-2-ynyl)amino]methyl]phenyl]methyl (4-nitrophenyl) carbonate |
|---|---|
| PubChem CID | 167089118 |
| Molecular Formula | C29H32N6O9 |
| Molecular Weight | 608.61 g/mol |
| Exact Mass | 608.22 |
| IUPAC Name | [4-[[5-(carbamoylamino)-2-(methylamino)pentanoyl]amino]-2-[[prop-2-ynoxycarbonyl(prop-2-ynyl)amino]methyl]phenyl]methyl (4-nitrophenyl) carbonate |
| SMILES | C#CCOC(=O)N(CC#C)Cc1cc(NC(=O)C(CCCNC(N)=O)NC)ccc1COC(=O)Oc1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C29H32N6O9/c1-4-15-34(28(38)42-16-5-2)18-21-17-22(33-26(36)25(31-3)7-6-14-32-27(30)37)9-8-20(21)19-43-29(39)44-24-12-10-23(11-13-24)35(40)41/h1-2,8-13,17,25,31H,6-7,14-16,18-19H2,3H3,(H,33,36)(H3,30,32,37) |
| InChIKey | FGFAQOKFCGWWBS-UHFFFAOYSA-N |
| XLogP | 2.49 |
| TPSA | 204.46 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 44 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 608.61 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenyl_carbonate', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|