C30H27FN2O5 — CID 177318497
[4-[[2,6-bis(phenylmethoxy)-3-pyridinyl]amino]-2-fluorophenyl] cyclobutanecarboperoxoate (PubChem CID 177318497) has the molecular formula C30H27FN2O5 and a molecular weight of 514.55 g/mol. Its IUPAC name is [4-[[2,6-bis(phenylmethoxy)-3-pyridinyl]amino]-2-fluorophenyl] cyclobutanecarboperoxoate.
| Compound Name | [4-[[2,6-bis(phenylmethoxy)-3-pyridinyl]amino]-2-fluorophenyl] cyclobutanecarboperoxoate |
|---|---|
| PubChem CID | 177318497 |
| Molecular Formula | C30H27FN2O5 |
| Molecular Weight | 514.55 g/mol |
| Exact Mass | 514.19 |
| IUPAC Name | [4-[[2,6-bis(phenylmethoxy)-3-pyridinyl]amino]-2-fluorophenyl] cyclobutanecarboperoxoate |
| SMILES | O=C(OOc1ccc(Nc2ccc(OCc3ccccc3)nc2OCc2ccccc2)cc1F)C1CCC1 |
| InChI | InChI=1S/C30H27FN2O5/c31-25-18-24(14-16-27(25)37-38-30(34)23-12-7-13-23)32-26-15-17-28(35-19-21-8-3-1-4-9-21)33-29(26)36-20-22-10-5-2-6-11-22/h1-6,8-11,14-18,23,32H,7,12-13,19-20H2 |
| InChIKey | IMBRNEMHHUSWHZ-UHFFFAOYSA-N |
| XLogP | 6.76 |
| TPSA | 78.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 514.55 |
| LogP ≤ 5 | 6.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|