C18H15ClN4S — CID 177319253
7-(4-chlorophenyl)-4,5,13-trimethyl-9-methylidene-3-thia-1,8,11,12-tetrazatricyclo[8.3.0.02,6]trideca-2(6),4,7,10,12-pentaene (PubChem CID 177319253) has the molecular formula C18H15ClN4S and a molecular weight of 354.87 g/mol. Its IUPAC name is 7-(4-chlorophenyl)-4,5,13-trimethyl-9-methylidene-3-thia-1,8,11,12-tetrazatricyclo[8.3.0.02,6]trideca-2(6),4,7,10,12-pentaene.
| Compound Name | 7-(4-chlorophenyl)-4,5,13-trimethyl-9-methylidene-3-thia-1,8,11,12-tetrazatricyclo[8.3.0.02,6]trideca-2(6),4,7,10,12-pentaene |
|---|---|
| PubChem CID | 177319253 |
| Molecular Formula | C18H15ClN4S |
| Molecular Weight | 354.87 g/mol |
| Exact Mass | 354.07 |
| IUPAC Name | 7-(4-chlorophenyl)-4,5,13-trimethyl-9-methylidene-3-thia-1,8,11,12-tetrazatricyclo[8.3.0.02,6]trideca-2(6),4,7,10,12-pentaene |
| SMILES | C=C1N=C(c2ccc(Cl)cc2)c2c(sc(C)c2C)-n2c(C)nnc21 |
| InChI | InChI=1S/C18H15ClN4S/c1-9-11(3)24-18-15(9)16(13-5-7-14(19)8-6-13)20-10(2)17-22-21-12(4)23(17)18/h5-8H,2H2,1,3-4H3 |
| InChIKey | CSDQKXXYRRMGEW-UHFFFAOYSA-N |
| XLogP | 4.73 |
| TPSA | 43.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.87 |
| LogP ≤ 5 | 4.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |