C19H20ClN5S — CID 57405434
7-(4-chlorophenyl)-N,4,5,9,13-pentamethyl-3-thia-1,8,11,12-tetrazatricyclo[8.3.0.02,6]trideca-2(6),4,7,10,12-pentaen-9-amine (PubChem CID 57405434) has the molecular formula C19H20ClN5S and a molecular weight of 385.92 g/mol. Its IUPAC name is 7-(4-chlorophenyl)-N,4,5,9,13-pentamethyl-3-thia-1,8,11,12-tetrazatricyclo[8.3.0.02,6]trideca-2(6),4,7,10,12-pentaen-9-amine.
| Compound Name | 7-(4-chlorophenyl)-N,4,5,9,13-pentamethyl-3-thia-1,8,11,12-tetrazatricyclo[8.3.0.02,6]trideca-2(6),4,7,10,12-pentaen-9-amine |
|---|---|
| PubChem CID | 57405434 |
| Molecular Formula | C19H20ClN5S |
| Molecular Weight | 385.92 g/mol |
| Exact Mass | 385.11 |
| IUPAC Name | 7-(4-chlorophenyl)-N,4,5,9,13-pentamethyl-3-thia-1,8,11,12-tetrazatricyclo[8.3.0.02,6]trideca-2(6),4,7,10,12-pentaen-9-amine |
| SMILES | CNC1(C)N=C(c2ccc(Cl)cc2)c2c(sc(C)c2C)-n2c(C)nnc21 |
| InChI | InChI=1S/C19H20ClN5S/c1-10-11(2)26-17-15(10)16(13-6-8-14(20)9-7-13)22-19(4,21-5)18-24-23-12(3)25(17)18/h6-9,21H,1-5H3 |
| InChIKey | ADTISCLRNQVOMK-UHFFFAOYSA-N |
| XLogP | 4.15 |
| TPSA | 55.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.92 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |