C24H29ClN4O2S — CID 123436752
2-[7-(4-chlorophenyl)-4,5,9,13-tetramethyl-3-thia-1,8,11,12-tetrazatricyclo[8.3.0.02,6]trideca-2(6),4,7,10,12-pentaen-9-yl]-1-[(2-methylpropan-2-yl)oxy]ethanol (PubChem CID 123436752) has the molecular formula C24H29ClN4O2S and a molecular weight of 473.04 g/mol. Its IUPAC name is 2-[7-(4-chlorophenyl)-4,5,9,13-tetramethyl-3-thia-1,8,11,12-tetrazatricyclo[8.3.0.02,6]trideca-2(6),4,7,10,12-pentaen-9-yl]-1-[(2-methylpropan-2-yl)oxy]ethanol.
| Compound Name | 2-[7-(4-chlorophenyl)-4,5,9,13-tetramethyl-3-thia-1,8,11,12-tetrazatricyclo[8.3.0.02,6]trideca-2(6),4,7,10,12-pentaen-9-yl]-1-[(2-methylpropan-2-yl)oxy]ethanol |
|---|---|
| PubChem CID | 123436752 |
| Molecular Formula | C24H29ClN4O2S |
| Molecular Weight | 473.04 g/mol |
| Exact Mass | 472.17 |
| IUPAC Name | 2-[7-(4-chlorophenyl)-4,5,9,13-tetramethyl-3-thia-1,8,11,12-tetrazatricyclo[8.3.0.02,6]trideca-2(6),4,7,10,12-pentaen-9-yl]-1-[(2-methylpropan-2-yl)oxy]ethanol |
| SMILES | Cc1sc2c(c1C)C(c1ccc(Cl)cc1)=NC(C)(CC(O)OC(C)(C)C)c1nnc(C)n1-2 |
| InChI | InChI=1S/C24H29ClN4O2S/c1-13-14(2)32-21-19(13)20(16-8-10-17(25)11-9-16)26-24(7,12-18(30)31-23(4,5)6)22-28-27-15(3)29(21)22/h8-11,18,30H,12H2,1-7H3 |
| InChIKey | JSERSMZZNYSEMJ-UHFFFAOYSA-N |
| XLogP | 5.50 |
| TPSA | 72.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.04 |
| LogP ≤ 5 | 5.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|