C11H19NO — CID 177320182
N-methyl-3-(3-methyl-4,5-dihydrooxepin-2-yl)propan-1-amine (PubChem CID 177320182) has the molecular formula C11H19NO and a molecular weight of 181.28 g/mol. Its IUPAC name is N-methyl-3-(3-methyl-4,5-dihydrooxepin-2-yl)propan-1-amine.
| Compound Name | N-methyl-3-(3-methyl-4,5-dihydrooxepin-2-yl)propan-1-amine |
|---|---|
| PubChem CID | 177320182 |
| Molecular Formula | C11H19NO |
| Molecular Weight | 181.28 g/mol |
| Exact Mass | 181.15 |
| IUPAC Name | N-methyl-3-(3-methyl-4,5-dihydrooxepin-2-yl)propan-1-amine |
| SMILES | CNCCCC1=C(C)CCC=CO1 |
| InChI | InChI=1S/C11H19NO/c1-10-6-3-4-9-13-11(10)7-5-8-12-2/h4,9,12H,3,5-8H2,1-2H3 |
| InChIKey | HHYOTNQGJMBFGN-UHFFFAOYSA-N |
| XLogP | 2.58 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 181.28 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|