C12H23NO — CID 177319942
4-[(Z)-but-1-enoxy]-N,5-dimethylhex-4-en-1-amine (PubChem CID 177319942) has the molecular formula C12H23NO and a molecular weight of 197.32 g/mol. Its IUPAC name is 4-[(Z)-but-1-enoxy]-N,5-dimethylhex-4-en-1-amine.
| Compound Name | 4-[(Z)-but-1-enoxy]-N,5-dimethylhex-4-en-1-amine |
|---|---|
| PubChem CID | 177319942 |
| Molecular Formula | C12H23NO |
| Molecular Weight | 197.32 g/mol |
| Exact Mass | 197.18 |
| IUPAC Name | 4-[(Z)-but-1-enoxy]-N,5-dimethylhex-4-en-1-amine |
| SMILES | CC/C=C\OC(CCCNC)=C(C)C |
| InChI | InChI=1S/C12H23NO/c1-5-6-10-14-12(11(2)3)8-7-9-13-4/h6,10,13H,5,7-9H2,1-4H3/b10-6- |
| InChIKey | AUOGLZHWMBYXQL-POHAHGRESA-N |
| XLogP | 3.22 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 197.32 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|