C34H44FNO4 — CID 177320458
ethane;4-[2-[[2-[2-(4-fluorophenyl)ethyl]-1-benzofuran-6-yl]methylamino]ethoxymethyl]benzaldehyde;2-methoxy-2-methylpropane (PubChem CID 177320458) has the molecular formula C34H44FNO4 and a molecular weight of 549.73 g/mol. Its IUPAC name is ethane;4-[2-[[2-[2-(4-fluorophenyl)ethyl]-1-benzofuran-6-yl]methylamino]ethoxymethyl]benzaldehyde;2-methoxy-2-methylpropane.
| Compound Name | ethane;4-[2-[[2-[2-(4-fluorophenyl)ethyl]-1-benzofuran-6-yl]methylamino]ethoxymethyl]benzaldehyde;2-methoxy-2-methylpropane |
|---|---|
| PubChem CID | 177320458 |
| Molecular Formula | C34H44FNO4 |
| Molecular Weight | 549.73 g/mol |
| Exact Mass | 549.33 |
| IUPAC Name | ethane;4-[2-[[2-[2-(4-fluorophenyl)ethyl]-1-benzofuran-6-yl]methylamino]ethoxymethyl]benzaldehyde;2-methoxy-2-methylpropane |
| SMILES | CC.COC(C)(C)C.O=Cc1ccc(COCCNCc2ccc3cc(CCc4ccc(F)cc4)oc3c2)cc1 |
| InChI | InChI=1S/C27H26FNO3.C5H12O.C2H6/c28-25-10-6-20(7-11-25)8-12-26-16-24-9-5-23(15-27(24)32-26)17-29-13-14-31-19-22-3-1-21(18-30)2-4-22;1-5(2,3)6-4;1-2/h1-7,9-11,15-16,18,29H,8,12-14,17,19H2;1-4H3;1-2H3 |
| InChIKey | KYYNTXDIHGZFOY-UHFFFAOYSA-N |
| XLogP | 7.93 |
| TPSA | 60.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 549.73 |
| LogP ≤ 5 | 7.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|