C28H36FNO5 — CID 177267129
tert-butyl 2-[3-[2-[[2-[2-(4-fluorophenyl)ethyl]-1-benzofuran-6-yl]methylamino]ethoxy]propoxy]acetate (PubChem CID 177267129) has the molecular formula C28H36FNO5 and a molecular weight of 485.60 g/mol. Its IUPAC name is tert-butyl 2-[3-[2-[[2-[2-(4-fluorophenyl)ethyl]-1-benzofuran-6-yl]methylamino]ethoxy]propoxy]acetate.
| Compound Name | tert-butyl 2-[3-[2-[[2-[2-(4-fluorophenyl)ethyl]-1-benzofuran-6-yl]methylamino]ethoxy]propoxy]acetate |
|---|---|
| PubChem CID | 177267129 |
| Molecular Formula | C28H36FNO5 |
| Molecular Weight | 485.60 g/mol |
| Exact Mass | 485.26 |
| IUPAC Name | tert-butyl 2-[3-[2-[[2-[2-(4-fluorophenyl)ethyl]-1-benzofuran-6-yl]methylamino]ethoxy]propoxy]acetate |
| SMILES | CC(C)(C)OC(=O)COCCCOCCNCc1ccc2cc(CCc3ccc(F)cc3)oc2c1 |
| InChI | InChI=1S/C28H36FNO5/c1-28(2,3)35-27(31)20-33-15-4-14-32-16-13-30-19-22-5-9-23-18-25(34-26(23)17-22)12-8-21-6-10-24(29)11-7-21/h5-7,9-11,17-18,30H,4,8,12-16,19-20H2,1-3H3 |
| InChIKey | CUENPVJEHMXSQR-UHFFFAOYSA-N |
| XLogP | 5.21 |
| TPSA | 69.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.60 |
| LogP ≤ 5 | 5.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|