C29H36F2N4O — CID 177320753
4-(4-amino-1,2,3,6-tetrahydropyridin-5-yl)-4-(4-fluoro-3,5-dimethylphenyl)imino-N-(2-fluoro-3-methylphenyl)-2,3-dimethyl-N-[(Z)-prop-1-enyl]butanamide (PubChem CID 177320753) has the molecular formula C29H36F2N4O and a molecular weight of 494.63 g/mol. Its IUPAC name is 4-(4-amino-1,2,3,6-tetrahydropyridin-5-yl)-4-(4-fluoro-3,5-dimethylphenyl)imino-N-(2-fluoro-3-methylphenyl)-2,3-dimethyl-N-[(Z)-prop-1-enyl]butanamide.
| Compound Name | 4-(4-amino-1,2,3,6-tetrahydropyridin-5-yl)-4-(4-fluoro-3,5-dimethylphenyl)imino-N-(2-fluoro-3-methylphenyl)-2,3-dimethyl-N-[(Z)-prop-1-enyl]butanamide |
|---|---|
| PubChem CID | 177320753 |
| Molecular Formula | C29H36F2N4O |
| Molecular Weight | 494.63 g/mol |
| Exact Mass | 494.29 |
| IUPAC Name | 4-(4-amino-1,2,3,6-tetrahydropyridin-5-yl)-4-(4-fluoro-3,5-dimethylphenyl)imino-N-(2-fluoro-3-methylphenyl)-2,3-dimethyl-N-[(Z)-prop-1-enyl]butanamide |
| SMILES | C/C=C\N(C(=O)C(C)C(C)/C(=N\c1cc(C)c(F)c(C)c1)C1=C(N)CCNC1)c1cccc(C)c1F |
| InChI | InChI=1S/C29H36F2N4O/c1-7-13-35(25-10-8-9-17(2)27(25)31)29(36)21(6)20(5)28(23-16-33-12-11-24(23)32)34-22-14-18(3)26(30)19(4)15-22/h7-10,13-15,20-21,33H,11-12,16,32H2,1-6H3/b13-7-,34-28+ |
| InChIKey | BHOXVEIICLCRND-IMRVNGNGSA-N |
| XLogP | 6.01 |
| TPSA | 70.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.63 |
| LogP ≤ 5 | 6.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|