C22H28N8OS — CID 177323186
4-[(4-amino-5-hydrazinyl-3,6-dihydro-2H-pyridin-1-yl)sulfanyl]-1,5-dimethyl-N-[(2-methylquinazolin-5-yl)methyl]pyrrole-2-carboxamide (PubChem CID 177323186) has the molecular formula C22H28N8OS and a molecular weight of 452.59 g/mol. Its IUPAC name is 4-[(4-amino-5-hydrazinyl-3,6-dihydro-2H-pyridin-1-yl)sulfanyl]-1,5-dimethyl-N-[(2-methylquinazolin-5-yl)methyl]pyrrole-2-carboxamide.
| Compound Name | 4-[(4-amino-5-hydrazinyl-3,6-dihydro-2H-pyridin-1-yl)sulfanyl]-1,5-dimethyl-N-[(2-methylquinazolin-5-yl)methyl]pyrrole-2-carboxamide |
|---|---|
| PubChem CID | 177323186 |
| Molecular Formula | C22H28N8OS |
| Molecular Weight | 452.59 g/mol |
| Exact Mass | 452.21 |
| IUPAC Name | 4-[(4-amino-5-hydrazinyl-3,6-dihydro-2H-pyridin-1-yl)sulfanyl]-1,5-dimethyl-N-[(2-methylquinazolin-5-yl)methyl]pyrrole-2-carboxamide |
| SMILES | Cc1ncc2c(CNC(=O)c3cc(SN4CCC(N)=C(NN)C4)c(C)n3C)cccc2n1 |
| InChI | InChI=1S/C22H28N8OS/c1-13-21(32-30-8-7-17(23)19(12-30)28-24)9-20(29(13)3)22(31)26-10-15-5-4-6-18-16(15)11-25-14(2)27-18/h4-6,9,11,28H,7-8,10,12,23-24H2,1-3H3,(H,26,31) |
| InChIKey | GNQYMLYYMCJFFY-UHFFFAOYSA-N |
| XLogP | 1.86 |
| TPSA | 127.12 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.59 |
| LogP ≤ 5 | 1.86 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|