C26H33FN6OS — CID 177323533
4-[(3Z)-3-(1-aminoethylidene)-5-fluoro-4-iminopiperidin-1-yl]sulfanyl-1,5-dimethyl-N-(quinolin-5-ylmethyl)pyrrole-2-carboxamide;ethane (PubChem CID 177323533) has the molecular formula C26H33FN6OS and a molecular weight of 496.66 g/mol. Its IUPAC name is 4-[(3Z)-3-(1-aminoethylidene)-5-fluoro-4-iminopiperidin-1-yl]sulfanyl-1,5-dimethyl-N-(quinolin-5-ylmethyl)pyrrole-2-carboxamide;ethane.
| Compound Name | 4-[(3Z)-3-(1-aminoethylidene)-5-fluoro-4-iminopiperidin-1-yl]sulfanyl-1,5-dimethyl-N-(quinolin-5-ylmethyl)pyrrole-2-carboxamide;ethane |
|---|---|
| PubChem CID | 177323533 |
| Molecular Formula | C26H33FN6OS |
| Molecular Weight | 496.66 g/mol |
| Exact Mass | 496.24 |
| IUPAC Name | 4-[(3Z)-3-(1-aminoethylidene)-5-fluoro-4-iminopiperidin-1-yl]sulfanyl-1,5-dimethyl-N-(quinolin-5-ylmethyl)pyrrole-2-carboxamide;ethane |
| SMILES | CC.[H]/N=C1C(=C(/C)N)/CN(Sc2cc(C(=O)NCc3cccc4ncccc34)n(C)c2C)CC/1F |
| InChI | InChI=1S/C24H27FN6OS.C2H6/c1-14(26)18-12-31(13-19(25)23(18)27)33-22-10-21(30(3)15(22)2)24(32)29-11-16-6-4-8-20-17(16)7-5-9-28-20;1-2/h4-10,19,27H,11-13,26H2,1-3H3,(H,29,32);1-2H3/b18-14-,27-23-; |
| InChIKey | PEAOGRFRSCJIHH-QKQWRQCESA-N |
| XLogP | 4.75 |
| TPSA | 100.03 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.66 |
| LogP ≤ 5 | 4.75 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|