C22H27N7OS — CID 177323520
4-[(3Z)-4-amino-3-(aminomethylidene)piperazin-1-yl]sulfanyl-1,5-dimethyl-N-(quinolin-5-ylmethyl)pyrrole-2-carboxamide (PubChem CID 177323520) has the molecular formula C22H27N7OS and a molecular weight of 437.57 g/mol. Its IUPAC name is 4-[(3Z)-4-amino-3-(aminomethylidene)piperazin-1-yl]sulfanyl-1,5-dimethyl-N-(quinolin-5-ylmethyl)pyrrole-2-carboxamide.
| Compound Name | 4-[(3Z)-4-amino-3-(aminomethylidene)piperazin-1-yl]sulfanyl-1,5-dimethyl-N-(quinolin-5-ylmethyl)pyrrole-2-carboxamide |
|---|---|
| PubChem CID | 177323520 |
| Molecular Formula | C22H27N7OS |
| Molecular Weight | 437.57 g/mol |
| Exact Mass | 437.20 |
| IUPAC Name | 4-[(3Z)-4-amino-3-(aminomethylidene)piperazin-1-yl]sulfanyl-1,5-dimethyl-N-(quinolin-5-ylmethyl)pyrrole-2-carboxamide |
| SMILES | Cc1c(SN2CCN(N)/C(=C\N)C2)cc(C(=O)NCc2cccc3ncccc23)n1C |
| InChI | InChI=1S/C22H27N7OS/c1-15-21(31-28-9-10-29(24)17(12-23)14-28)11-20(27(15)2)22(30)26-13-16-5-3-7-19-18(16)6-4-8-25-19/h3-8,11-12H,9-10,13-14,23-24H2,1-2H3,(H,26,30)/b17-12- |
| InChIKey | KOBWPBMGSZWOHS-ATVHPVEESA-N |
| XLogP | 2.11 |
| TPSA | 105.44 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.57 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|