C26H27N3O6 — CID 177324221
(7-oxophenoxazin-3-yl) N-[2-[cycloocta-2,3-dien-1-yloxycarbonyl(methyl)amino]ethyl]-N-methylcarbamate (PubChem CID 177324221) has the molecular formula C26H27N3O6 and a molecular weight of 477.52 g/mol. Its IUPAC name is (7-oxophenoxazin-3-yl) N-[2-[cycloocta-2,3-dien-1-yloxycarbonyl(methyl)amino]ethyl]-N-methylcarbamate.
| Compound Name | (7-oxophenoxazin-3-yl) N-[2-[cycloocta-2,3-dien-1-yloxycarbonyl(methyl)amino]ethyl]-N-methylcarbamate |
|---|---|
| PubChem CID | 177324221 |
| Molecular Formula | C26H27N3O6 |
| Molecular Weight | 477.52 g/mol |
| Exact Mass | 477.19 |
| IUPAC Name | (7-oxophenoxazin-3-yl) N-[2-[cycloocta-2,3-dien-1-yloxycarbonyl(methyl)amino]ethyl]-N-methylcarbamate |
| SMILES | CN(CCN(C)C(=O)OC1C=C=CCCCC1)C(=O)Oc1ccc2nc3ccc(=O)cc-3oc2c1 |
| InChI | InChI=1S/C26H27N3O6/c1-28(25(31)33-19-8-6-4-3-5-7-9-19)14-15-29(2)26(32)34-20-11-13-22-24(17-20)35-23-16-18(30)10-12-21(23)27-22/h4,8,10-13,16-17,19H,3,5,7,9,14-15H2,1-2H3 |
| InChIKey | XGNIVZYFQFAOQR-UHFFFAOYSA-N |
| XLogP | 4.45 |
| TPSA | 102.18 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.52 |
| LogP ≤ 5 | 4.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|