C27H20O5 — CID 177324263
[9-(2-methylphenyl)-3,6-bis(prop-2-ynoxy)xanthen-9-yl] formate (PubChem CID 177324263) has the molecular formula C27H20O5 and a molecular weight of 424.45 g/mol. Its IUPAC name is [9-(2-methylphenyl)-3,6-bis(prop-2-ynoxy)xanthen-9-yl] formate.
| Compound Name | [9-(2-methylphenyl)-3,6-bis(prop-2-ynoxy)xanthen-9-yl] formate |
|---|---|
| PubChem CID | 177324263 |
| Molecular Formula | C27H20O5 |
| Molecular Weight | 424.45 g/mol |
| Exact Mass | 424.13 |
| IUPAC Name | [9-(2-methylphenyl)-3,6-bis(prop-2-ynoxy)xanthen-9-yl] formate |
| SMILES | C#CCOc1ccc2c(c1)Oc1cc(OCC#C)ccc1C2(OC=O)c1ccccc1C |
| InChI | InChI=1S/C27H20O5/c1-4-14-29-20-10-12-23-25(16-20)32-26-17-21(30-15-5-2)11-13-24(26)27(23,31-18-28)22-9-7-6-8-19(22)3/h1-2,6-13,16-18H,14-15H2,3H3 |
| InChIKey | OEMKWNZESUVDAN-UHFFFAOYSA-N |
| XLogP | 4.59 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.45 |
| LogP ≤ 5 | 4.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|