C30H30NO2+ — CID 71569880
1-ethyl-3,3-dimethyl-2-[(E)-2-(6-prop-2-ynoxy-2,3-dihydro-1H-xanthen-4-yl)ethenyl]indol-1-ium (PubChem CID 71569880) has the molecular formula C30H30NO2+ and a molecular weight of 436.58 g/mol. Its IUPAC name is 1-ethyl-3,3-dimethyl-2-[(E)-2-(6-prop-2-ynoxy-2,3-dihydro-1H-xanthen-4-yl)ethenyl]indol-1-ium.
| Compound Name | 1-ethyl-3,3-dimethyl-2-[(E)-2-(6-prop-2-ynoxy-2,3-dihydro-1H-xanthen-4-yl)ethenyl]indol-1-ium |
|---|---|
| PubChem CID | 71569880 |
| Molecular Formula | C30H30NO2+ |
| Molecular Weight | 436.58 g/mol |
| Exact Mass | 436.23 |
| IUPAC Name | 1-ethyl-3,3-dimethyl-2-[(E)-2-(6-prop-2-ynoxy-2,3-dihydro-1H-xanthen-4-yl)ethenyl]indol-1-ium |
| SMILES | C#CCOc1ccc2c(c1)OC1=C(/C=C/C3=[N+](CC)c4ccccc4C3(C)C)CCCC1=C2 |
| InChI | InChI=1S/C30H30NO2/c1-5-18-32-24-16-14-22-19-23-11-9-10-21(29(23)33-27(22)20-24)15-17-28-30(3,4)25-12-7-8-13-26(25)31(28)6-2/h1,7-8,12-17,19-20H,6,9-11,18H2,2-4H3/q+1/b17-15+ |
| InChIKey | JYUSKVKINISSPM-BMRADRMJSA-N |
| XLogP | 6.56 |
| TPSA | 21.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.58 |
| LogP ≤ 5 | 6.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|