C28H30NO2+ — CID 138108643
5-[2-(3,3-dimethyl-1-propylindol-1-ium-2-yl)ethenyl]-7,8-dihydro-6H-xanthen-3-ol (PubChem CID 138108643) has the molecular formula C28H30NO2+ and a molecular weight of 412.55 g/mol. Its IUPAC name is 5-[2-(3,3-dimethyl-1-propylindol-1-ium-2-yl)ethenyl]-7,8-dihydro-6H-xanthen-3-ol.
| Compound Name | 5-[2-(3,3-dimethyl-1-propylindol-1-ium-2-yl)ethenyl]-7,8-dihydro-6H-xanthen-3-ol |
|---|---|
| PubChem CID | 138108643 |
| Molecular Formula | C28H30NO2+ |
| Molecular Weight | 412.55 g/mol |
| Exact Mass | 412.23 |
| IUPAC Name | 5-[2-(3,3-dimethyl-1-propylindol-1-ium-2-yl)ethenyl]-7,8-dihydro-6H-xanthen-3-ol |
| SMILES | CCC[N+]1=C(C=CC2=C3Oc4cc(O)ccc4C=C3CCC2)C(C)(C)c2ccccc21 |
| InChI | InChI=1S/C28H29NO2/c1-4-16-29-24-11-6-5-10-23(24)28(2,3)26(29)15-13-19-8-7-9-21-17-20-12-14-22(30)18-25(20)31-27(19)21/h5-6,10-15,17-18H,4,7-9,16H2,1-3H3/p+1 |
| InChIKey | HGOKPWZDARYEFY-UHFFFAOYSA-O |
| XLogP | 6.65 |
| TPSA | 32.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.55 |
| LogP ≤ 5 | 6.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|