C27H29NO4S — CID 169106331
ethane;[3-hydroxy-9-[2-methyl-4-(2-methylpropanethioylamino)phenyl]xanthen-9-yl] formate (PubChem CID 169106331) has the molecular formula C27H29NO4S and a molecular weight of 463.60 g/mol. Its IUPAC name is ethane;[3-hydroxy-9-[2-methyl-4-(2-methylpropanethioylamino)phenyl]xanthen-9-yl] formate.
| Compound Name | ethane;[3-hydroxy-9-[2-methyl-4-(2-methylpropanethioylamino)phenyl]xanthen-9-yl] formate |
|---|---|
| PubChem CID | 169106331 |
| Molecular Formula | C27H29NO4S |
| Molecular Weight | 463.60 g/mol |
| Exact Mass | 463.18 |
| IUPAC Name | ethane;[3-hydroxy-9-[2-methyl-4-(2-methylpropanethioylamino)phenyl]xanthen-9-yl] formate |
| SMILES | CC.Cc1cc(NC(=S)C(C)C)ccc1C1(OC=O)c2ccccc2Oc2cc(O)ccc21 |
| InChI | InChI=1S/C25H23NO4S.C2H6/c1-15(2)24(31)26-17-8-10-19(16(3)12-17)25(29-14-27)20-6-4-5-7-22(20)30-23-13-18(28)9-11-21(23)25;1-2/h4-15,28H,1-3H3,(H,26,31);1-2H3 |
| InChIKey | FFOLRFACHOTABD-UHFFFAOYSA-N |
| XLogP | 6.69 |
| TPSA | 67.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.60 |
| LogP ≤ 5 | 6.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|