C23H19NO4S — CID 143031749
N-[(E,3E)-3-[(4E)-4-ethylidene-3'-hydroxy-5-oxospiro[oxolane-2,9'-xanthene]-3-ylidene]prop-1-enyl]ethanethioamide (PubChem CID 143031749) has the molecular formula C23H19NO4S and a molecular weight of 405.48 g/mol. Its IUPAC name is N-[(E,3E)-3-[(4E)-4-ethylidene-3'-hydroxy-5-oxospiro[oxolane-2,9'-xanthene]-3-ylidene]prop-1-enyl]ethanethioamide.
| Compound Name | N-[(E,3E)-3-[(4E)-4-ethylidene-3'-hydroxy-5-oxospiro[oxolane-2,9'-xanthene]-3-ylidene]prop-1-enyl]ethanethioamide |
|---|---|
| PubChem CID | 143031749 |
| Molecular Formula | C23H19NO4S |
| Molecular Weight | 405.48 g/mol |
| Exact Mass | 405.10 |
| IUPAC Name | N-[(E,3E)-3-[(4E)-4-ethylidene-3'-hydroxy-5-oxospiro[oxolane-2,9'-xanthene]-3-ylidene]prop-1-enyl]ethanethioamide |
| SMILES | C/C=C1/C(=O)OC2(/C1=C/C=C/NC(C)=S)c1ccccc1Oc1cc(O)ccc12 |
| InChI | InChI=1S/C23H19NO4S/c1-3-16-17(8-6-12-24-14(2)29)23(28-22(16)26)18-7-4-5-9-20(18)27-21-13-15(25)10-11-19(21)23/h3-13,25H,1-2H3,(H,24,29)/b12-6+,16-3+,17-8+ |
| InChIKey | SDGSSGCPFMZGMT-ZQVDBGAVSA-N |
| XLogP | 4.62 |
| TPSA | 67.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.48 |
| LogP ≤ 5 | 4.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|