C22H20O3 — CID 142010188
(3E,4E)-3,4-di(ethylidene)-3',6'-dimethylspiro[oxolane-5,9'-xanthene]-2-one (PubChem CID 142010188) has the molecular formula C22H20O3 and a molecular weight of 332.40 g/mol. Its IUPAC name is (3E,4E)-3,4-di(ethylidene)-3',6'-dimethylspiro[oxolane-5,9'-xanthene]-2-one.
| Compound Name | (3E,4E)-3,4-di(ethylidene)-3',6'-dimethylspiro[oxolane-5,9'-xanthene]-2-one |
|---|---|
| PubChem CID | 142010188 |
| Molecular Formula | C22H20O3 |
| Molecular Weight | 332.40 g/mol |
| Exact Mass | 332.14 |
| IUPAC Name | (3E,4E)-3,4-di(ethylidene)-3',6'-dimethylspiro[oxolane-5,9'-xanthene]-2-one |
| SMILES | C/C=C1/C(=O)OC2(/C1=C/C)c1ccc(C)cc1Oc1cc(C)ccc12 |
| InChI | InChI=1S/C22H20O3/c1-5-15-16(6-2)22(25-21(15)23)17-9-7-13(3)11-19(17)24-20-12-14(4)8-10-18(20)22/h5-12H,1-4H3/b15-5+,16-6+ |
| InChIKey | DEPLZDLGBMQERN-IAGONARPSA-N |
| XLogP | 5.10 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.40 |
| LogP ≤ 5 | 5.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|