C34H31NO11 — CID 173479360
(2,5-dioxopyrrolidin-1-yl) (E,4E)-4-[4-ethylidene-3',6'-bis(2-methylpropanoyloxy)-2-oxospiro[oxolane-5,9'-xanthene]-3-ylidene]but-2-enoate (PubChem CID 173479360) has the molecular formula C34H31NO11 and a molecular weight of 629.62 g/mol. Its IUPAC name is (2,5-dioxopyrrolidin-1-yl) (E,4E)-4-[4-ethylidene-3',6'-bis(2-methylpropanoyloxy)-2-oxospiro[oxolane-5,9'-xanthene]-3-ylidene]but-2-enoate.
| Compound Name | (2,5-dioxopyrrolidin-1-yl) (E,4E)-4-[4-ethylidene-3',6'-bis(2-methylpropanoyloxy)-2-oxospiro[oxolane-5,9'-xanthene]-3-ylidene]but-2-enoate |
|---|---|
| PubChem CID | 173479360 |
| Molecular Formula | C34H31NO11 |
| Molecular Weight | 629.62 g/mol |
| Exact Mass | 629.19 |
| IUPAC Name | (2,5-dioxopyrrolidin-1-yl) (E,4E)-4-[4-ethylidene-3',6'-bis(2-methylpropanoyloxy)-2-oxospiro[oxolane-5,9'-xanthene]-3-ylidene]but-2-enoate |
| SMILES | CC=C1/C(=C\C=C\C(=O)ON2C(=O)CCC2=O)C(=O)OC12c1ccc(OC(=O)C(C)C)cc1Oc1cc(OC(=O)C(C)C)ccc12 |
| InChI | InChI=1S/C34H31NO11/c1-6-23-22(8-7-9-30(38)46-35-28(36)14-15-29(35)37)33(41)45-34(23)24-12-10-20(42-31(39)18(2)3)16-26(24)44-27-17-21(11-13-25(27)34)43-32(40)19(4)5/h6-13,16-19H,14-15H2,1-5H3/b9-7+,22-8+,23-6? |
| InChIKey | LTBPDMINSHKZML-VGWAOYTKSA-N |
| XLogP | 4.75 |
| TPSA | 151.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 629.62 |
| LogP ≤ 5 | 4.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|