C33H24N2O9 — CID 164741852
(2,5-dioxopyrrolidin-1-yl) 2-[6'-[(1-methyl-2H-pyridin-1-ium-2-id-4-yl)methoxy]-3-oxospiro[2-benzofuran-1,9'-xanthene]-3'-yl]oxyacetate (PubChem CID 164741852) has the molecular formula C33H24N2O9 and a molecular weight of 592.56 g/mol. Its IUPAC name is (2,5-dioxopyrrolidin-1-yl) 2-[6'-[(1-methyl-2H-pyridin-1-ium-2-id-4-yl)methoxy]-3-oxospiro[2-benzofuran-1,9'-xanthene]-3'-yl]oxyacetate.
| Compound Name | (2,5-dioxopyrrolidin-1-yl) 2-[6'-[(1-methyl-2H-pyridin-1-ium-2-id-4-yl)methoxy]-3-oxospiro[2-benzofuran-1,9'-xanthene]-3'-yl]oxyacetate |
|---|---|
| PubChem CID | 164741852 |
| Molecular Formula | C33H24N2O9 |
| Molecular Weight | 592.56 g/mol |
| Exact Mass | 592.15 |
| IUPAC Name | (2,5-dioxopyrrolidin-1-yl) 2-[6'-[(1-methyl-2H-pyridin-1-ium-2-id-4-yl)methoxy]-3-oxospiro[2-benzofuran-1,9'-xanthene]-3'-yl]oxyacetate |
| SMILES | C[n+]1[c-]cc(COc2ccc3c(c2)Oc2cc(OCC(=O)ON4C(=O)CCC4=O)ccc2C32OC(=O)c3ccccc32)cc1 |
| InChI | InChI=1S/C33H24N2O9/c1-34-14-12-20(13-15-34)18-40-21-6-8-25-27(16-21)42-28-17-22(41-19-31(38)44-35-29(36)10-11-30(35)37)7-9-26(28)33(25)24-5-3-2-4-23(24)32(39)43-33/h2-9,12-14,16-17H,10-11,18-19H2,1H3 |
| InChIKey | PXZFYHGSQDDQGG-UHFFFAOYSA-N |
| XLogP | 3.44 |
| TPSA | 121.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 44 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 592.56 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|