C33H29NO11 — CID 142095172
[6-[(2,5-dioxopyrrolidin-1-yl)oxy-hydroxymethyl]-6'-(2-methylpropanoyloxy)-3-oxospiro[2-benzofuran-1,9'-xanthene]-3'-yl] 2-methylpropanoate (PubChem CID 142095172) has the molecular formula C33H29NO11 and a molecular weight of 615.59 g/mol. Its IUPAC name is [6-[(2,5-dioxopyrrolidin-1-yl)oxy-hydroxymethyl]-6'-(2-methylpropanoyloxy)-3-oxospiro[2-benzofuran-1,9'-xanthene]-3'-yl] 2-methylpropanoate.
| Compound Name | [6-[(2,5-dioxopyrrolidin-1-yl)oxy-hydroxymethyl]-6'-(2-methylpropanoyloxy)-3-oxospiro[2-benzofuran-1,9'-xanthene]-3'-yl] 2-methylpropanoate |
|---|---|
| PubChem CID | 142095172 |
| Molecular Formula | C33H29NO11 |
| Molecular Weight | 615.59 g/mol |
| Exact Mass | 615.17 |
| IUPAC Name | [6-[(2,5-dioxopyrrolidin-1-yl)oxy-hydroxymethyl]-6'-(2-methylpropanoyloxy)-3-oxospiro[2-benzofuran-1,9'-xanthene]-3'-yl] 2-methylpropanoate |
| SMILES | CC(C)C(=O)Oc1ccc2c(c1)Oc1cc(OC(=O)C(C)C)ccc1C21OC(=O)c2ccc(C(O)ON3C(=O)CCC3=O)cc21 |
| InChI | InChI=1S/C33H29NO11/c1-16(2)29(37)41-19-6-9-22-25(14-19)43-26-15-20(42-30(38)17(3)4)7-10-23(26)33(22)24-13-18(5-8-21(24)32(40)44-33)31(39)45-34-27(35)11-12-28(34)36/h5-10,13-17,31,39H,11-12H2,1-4H3 |
| InChIKey | QFVPSJHHEZFFCT-UHFFFAOYSA-N |
| XLogP | 4.45 |
| TPSA | 154.97 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 615.59 |
| LogP ≤ 5 | 4.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|