About ethanethiol;2-iodooxypropan-2-yl 2-[[4-(hydroxymethyl)cyclohexyl]methoxy]acetate
ethanethiol;2-iodooxypropan-2-yl 2-[[4-(hydroxymethyl)cyclohexyl]methoxy]acetate (PubChem CID 177324918) has the molecular formula C15H29IO5S
and a molecular weight of 448.36 g/mol. Its IUPAC name is ethanethiol;2-iodooxypropan-2-yl 2-[[4-(hydroxymethyl)cyclohexyl]methoxy]acetate.
Molecular Properties
| Compound Name | ethanethiol;2-iodooxypropan-2-yl 2-[[4-(hydroxymethyl)cyclohexyl]methoxy]acetate |
| PubChem CID | 177324918 |
| Molecular Formula | C15H29IO5S |
| Molecular Weight | 448.36 g/mol |
| Exact Mass | 448.08 |
| IUPAC Name | ethanethiol;2-iodooxypropan-2-yl 2-[[4-(hydroxymethyl)cyclohexyl]methoxy]acetate |
| SMILES | CC(C)(OI)OC(=O)COCC1CCC(CO)CC1.CCS |
| InChI | InChI=1S/C13H23IO5.C2H6S/c1-13(2,19-14)18-12(16)9-17-8-11-5-3-10(7-15)4-6-11;1-2-3/h10-11,15H,3-9H2,1-2H3;3H,2H2,1H3 |
| InChIKey | ZLNLTBYZHCCNGG-UHFFFAOYSA-N |
| XLogP | 3.38 |
| TPSA | 64.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 448.36 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|
Analyze ethanethiol;2-iodooxypropan-2-yl 2-[[4-(hydroxymethyl)cyclohexyl]methoxy]acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethanethiol;2-iodooxypropan-2-yl 2-[[4-(hydroxymethyl)cyclohexyl]methoxy]acetate?
The IUPAC name of ethanethiol;2-iodooxypropan-2-yl 2-[[4-(hydroxymethyl)cyclohexyl]methoxy]acetate (CID 177324918) is ethanethiol;2-iodooxypropan-2-yl 2-[[4-(hydroxymethyl)cyclohexyl]methoxy]acetate.
What is the SMILES notation for ethanethiol;2-iodooxypropan-2-yl 2-[[4-(hydroxymethyl)cyclohexyl]methoxy]acetate?
The canonical SMILES for ethanethiol;2-iodooxypropan-2-yl 2-[[4-(hydroxymethyl)cyclohexyl]methoxy]acetate is CC(C)(OI)OC(=O)COCC1CCC(CO)CC1.CCS.
What is the InChIKey of ethanethiol;2-iodooxypropan-2-yl 2-[[4-(hydroxymethyl)cyclohexyl]methoxy]acetate?
The InChIKey is ZLNLTBYZHCCNGG-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H23IO5.C2H6S/c1-13(2,19-14)18-12(16)9-17-8-11-5-3-10(7-15)4-6-11;1-2-3/h10-11,15H,3-9H2,1-2H3;3H,2H2,1H3.
What are the key properties of ethanethiol;2-iodooxypropan-2-yl 2-[[4-(hydroxymethyl)cyclohexyl]methoxy]acetate?
ethanethiol;2-iodooxypropan-2-yl 2-[[4-(hydroxymethyl)cyclohexyl]methoxy]acetate has a molecular weight of 448.36 g/mol, XLogP of 3.38, 7 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for ethanethiol;2-iodooxypropan-2-yl 2-[[4-(hydroxymethyl)cyclohexyl]methoxy]acetate is sourced from PubChem (CID 177324918), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).