About lawrencium;propan-2-ylcyclopentane
lawrencium;propan-2-ylcyclopentane (PubChem CID 177328066) has the molecular formula C8H15Lr-
and a molecular weight of 373.21 g/mol. Its IUPAC name is lawrencium;propan-2-ylcyclopentane.
Molecular Properties
| Compound Name | lawrencium;propan-2-ylcyclopentane |
| PubChem CID | 177328066 |
| Molecular Formula | C8H15Lr- |
| Molecular Weight | 373.21 g/mol |
| Exact Mass | 373.23 |
| IUPAC Name | lawrencium;propan-2-ylcyclopentane |
| SMILES | CC(C)C1C[CH-]CC1.[Lr] |
| InChI | InChI=1S/C8H15.Lr/c1-7(2)8-5-3-4-6-8;/h3,7-8H,4-6H2,1-2H3;/q-1; |
| InChIKey | WZOBIYXGPPSQFY-UHFFFAOYSA-N |
| XLogP | 2.65 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 373.21 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|
Analyze lawrencium;propan-2-ylcyclopentane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of lawrencium;propan-2-ylcyclopentane?
The IUPAC name of lawrencium;propan-2-ylcyclopentane (CID 177328066) is lawrencium;propan-2-ylcyclopentane.
What is the SMILES notation for lawrencium;propan-2-ylcyclopentane?
The canonical SMILES for lawrencium;propan-2-ylcyclopentane is CC(C)C1C[CH-]CC1.[Lr].
What is the InChIKey of lawrencium;propan-2-ylcyclopentane?
The InChIKey is WZOBIYXGPPSQFY-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H15.Lr/c1-7(2)8-5-3-4-6-8;/h3,7-8H,4-6H2,1-2H3;/q-1;.
What are the key properties of lawrencium;propan-2-ylcyclopentane?
lawrencium;propan-2-ylcyclopentane has a molecular weight of 373.21 g/mol, XLogP of 2.65, 1 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for lawrencium;propan-2-ylcyclopentane is sourced from PubChem (CID 177328066), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).