C14H12F4N2O3S — CID 177334320
N-(2,5-difluoro-4-hydroxyphenyl)-6,6-difluoro-1,4,5,7-tetrahydroindole-3-sulfonamide (PubChem CID 177334320) has the molecular formula C14H12F4N2O3S and a molecular weight of 364.32 g/mol. Its IUPAC name is N-(2,5-difluoro-4-hydroxyphenyl)-6,6-difluoro-1,4,5,7-tetrahydroindole-3-sulfonamide.
| Compound Name | N-(2,5-difluoro-4-hydroxyphenyl)-6,6-difluoro-1,4,5,7-tetrahydroindole-3-sulfonamide |
|---|---|
| PubChem CID | 177334320 |
| Molecular Formula | C14H12F4N2O3S |
| Molecular Weight | 364.32 g/mol |
| Exact Mass | 364.05 |
| IUPAC Name | N-(2,5-difluoro-4-hydroxyphenyl)-6,6-difluoro-1,4,5,7-tetrahydroindole-3-sulfonamide |
| SMILES | O=S(=O)(Nc1cc(F)c(O)cc1F)c1c[nH]c2c1CCC(F)(F)C2 |
| InChI | InChI=1S/C14H12F4N2O3S/c15-8-4-12(21)9(16)3-10(8)20-24(22,23)13-6-19-11-5-14(17,18)2-1-7(11)13/h3-4,6,19-21H,1-2,5H2 |
| InChIKey | BHUWUKQMGVIJKA-UHFFFAOYSA-N |
| XLogP | 2.92 |
| TPSA | 82.19 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.32 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'sulfonamide_B(41)', 'substructure': 'N/A'}, {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|