C13H11BrF2N2O4S2 — CID 177334477
N-(4-bromo-2,5-difluorophenyl)-6,6-dioxo-1,4,5,7-tetrahydrothiopyrano[3,4-b]pyrrole-3-sulfonamide (PubChem CID 177334477) has the molecular formula C13H11BrF2N2O4S2 and a molecular weight of 441.28 g/mol. Its IUPAC name is N-(4-bromo-2,5-difluorophenyl)-6,6-dioxo-1,4,5,7-tetrahydrothiopyrano[3,4-b]pyrrole-3-sulfonamide.
| Compound Name | N-(4-bromo-2,5-difluorophenyl)-6,6-dioxo-1,4,5,7-tetrahydrothiopyrano[3,4-b]pyrrole-3-sulfonamide |
|---|---|
| PubChem CID | 177334477 |
| Molecular Formula | C13H11BrF2N2O4S2 |
| Molecular Weight | 441.28 g/mol |
| Exact Mass | 439.93 |
| IUPAC Name | N-(4-bromo-2,5-difluorophenyl)-6,6-dioxo-1,4,5,7-tetrahydrothiopyrano[3,4-b]pyrrole-3-sulfonamide |
| SMILES | O=S1(=O)CCc2c(S(=O)(=O)Nc3cc(F)c(Br)cc3F)c[nH]c2C1 |
| InChI | InChI=1S/C13H11BrF2N2O4S2/c14-8-3-10(16)11(4-9(8)15)18-24(21,22)13-5-17-12-6-23(19,20)2-1-7(12)13/h3-5,17-18H,1-2,6H2 |
| InChIKey | HMMVMSQQPXCVQV-UHFFFAOYSA-N |
| XLogP | 2.33 |
| TPSA | 96.10 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.28 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|