C14H13BrF2N2O2S — CID 166153216
N-(4-bromo-2,5-difluorophenyl)-5-cyclobutyl-1H-pyrrole-3-sulfonamide (PubChem CID 166153216) has the molecular formula C14H13BrF2N2O2S and a molecular weight of 391.24 g/mol. Its IUPAC name is N-(4-bromo-2,5-difluorophenyl)-5-cyclobutyl-1H-pyrrole-3-sulfonamide.
| Compound Name | N-(4-bromo-2,5-difluorophenyl)-5-cyclobutyl-1H-pyrrole-3-sulfonamide |
|---|---|
| PubChem CID | 166153216 |
| Molecular Formula | C14H13BrF2N2O2S |
| Molecular Weight | 391.24 g/mol |
| Exact Mass | 389.98 |
| IUPAC Name | N-(4-bromo-2,5-difluorophenyl)-5-cyclobutyl-1H-pyrrole-3-sulfonamide |
| SMILES | O=S(=O)(Nc1cc(F)c(Br)cc1F)c1c[nH]c(C2CCC2)c1 |
| InChI | InChI=1S/C14H13BrF2N2O2S/c15-10-5-12(17)14(6-11(10)16)19-22(20,21)9-4-13(18-7-9)8-2-1-3-8/h4-8,18-19H,1-3H2 |
| InChIKey | MVBOVXHCUUAUNT-UHFFFAOYSA-N |
| XLogP | 4.12 |
| TPSA | 61.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.24 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|