C10H6BrF3N2O2S — CID 166153357
5-bromo-N-(2,4,5-trifluorophenyl)-1H-pyrrole-3-sulfonamide (PubChem CID 166153357) has the molecular formula C10H6BrF3N2O2S and a molecular weight of 355.14 g/mol. Its IUPAC name is 5-bromo-N-(2,4,5-trifluorophenyl)-1H-pyrrole-3-sulfonamide.
| Compound Name | 5-bromo-N-(2,4,5-trifluorophenyl)-1H-pyrrole-3-sulfonamide |
|---|---|
| PubChem CID | 166153357 |
| Molecular Formula | C10H6BrF3N2O2S |
| Molecular Weight | 355.14 g/mol |
| Exact Mass | 353.93 |
| IUPAC Name | 5-bromo-N-(2,4,5-trifluorophenyl)-1H-pyrrole-3-sulfonamide |
| SMILES | O=S(=O)(Nc1cc(F)c(F)cc1F)c1c[nH]c(Br)c1 |
| InChI | InChI=1S/C10H6BrF3N2O2S/c11-10-1-5(4-15-10)19(17,18)16-9-3-7(13)6(12)2-8(9)14/h1-4,15-16H |
| InChIKey | QQKNYGMCTONZJZ-UHFFFAOYSA-N |
| XLogP | 3.00 |
| TPSA | 61.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.14 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|