C16H14BrF2N3O3S — CID 177334465
N-(4-bromo-2,5-difluorophenyl)-6-cyano-6-(trideuteriomethoxy)-1,4,5,7-tetrahydroindole-3-sulfonamide (PubChem CID 177334465) has the molecular formula C16H14BrF2N3O3S and a molecular weight of 449.29 g/mol. Its IUPAC name is N-(4-bromo-2,5-difluorophenyl)-6-cyano-6-(trideuteriomethoxy)-1,4,5,7-tetrahydroindole-3-sulfonamide.
| Compound Name | N-(4-bromo-2,5-difluorophenyl)-6-cyano-6-(trideuteriomethoxy)-1,4,5,7-tetrahydroindole-3-sulfonamide |
|---|---|
| PubChem CID | 177334465 |
| Molecular Formula | C16H14BrF2N3O3S |
| Molecular Weight | 449.29 g/mol |
| Exact Mass | 448.01 |
| IUPAC Name | N-(4-bromo-2,5-difluorophenyl)-6-cyano-6-(trideuteriomethoxy)-1,4,5,7-tetrahydroindole-3-sulfonamide |
| SMILES | [2H]C([2H])([2H])OC1(C#N)CCc2c(S(=O)(=O)Nc3cc(F)c(Br)cc3F)c[nH]c2C1 |
| InChI | InChI=1S/C16H14BrF2N3O3S/c1-25-16(8-20)3-2-9-14(6-16)21-7-15(9)26(23,24)22-13-5-11(18)10(17)4-12(13)19/h4-5,7,21-22H,2-3,6H2,1H3/i1D3 |
| InChIKey | RRFUUKLHVAZHTA-FIBGUPNXSA-N |
| XLogP | 3.25 |
| TPSA | 94.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.29 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|