C16H23FN5O2Pd- — CID 177336792
amino-[(Z)-[amino-[4-[2-(cyclopropylmethoxy)ethyl]-6-fluoro-7-methyl-2,3-dihydro-1,4-benzoxazin-5-yl]methylidene]amino]azanide;palladium (PubChem CID 177336792) has the molecular formula C16H23FN5O2Pd- and a molecular weight of 442.81 g/mol. Its IUPAC name is amino-[(Z)-[amino-[4-[2-(cyclopropylmethoxy)ethyl]-6-fluoro-7-methyl-2,3-dihydro-1,4-benzoxazin-5-yl]methylidene]amino]azanide;palladium.
| Compound Name | amino-[(Z)-[amino-[4-[2-(cyclopropylmethoxy)ethyl]-6-fluoro-7-methyl-2,3-dihydro-1,4-benzoxazin-5-yl]methylidene]amino]azanide;palladium |
|---|---|
| PubChem CID | 177336792 |
| Molecular Formula | C16H23FN5O2Pd- |
| Molecular Weight | 442.81 g/mol |
| Exact Mass | 442.09 |
| IUPAC Name | amino-[(Z)-[amino-[4-[2-(cyclopropylmethoxy)ethyl]-6-fluoro-7-methyl-2,3-dihydro-1,4-benzoxazin-5-yl]methylidene]amino]azanide;palladium |
| SMILES | Cc1cc2c(c(/C(N)=N/[N-]N)c1F)N(CCOCC1CC1)CCO2.[Pd] |
| InChI | InChI=1S/C16H23FN5O2.Pd/c1-10-8-12-15(13(14(10)17)16(18)20-21-19)22(5-7-24-12)4-6-23-9-11-2-3-11;/h8,11H,2-7,9,19H2,1H3,(H2,18,20);/q-1; |
| InChIKey | SNUNMNLGRPZNKJ-UHFFFAOYSA-N |
| XLogP | 1.62 |
| TPSA | 100.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.81 |
| LogP ≤ 5 | 1.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|