C18H19ClF3N5O2 — CID 177336801
N'-[amino(methoxymethyl)amino]-7-chloro-4-[(2,4-difluorophenyl)methyl]-6-fluoro-2,3-dihydro-1,4-benzoxazine-5-carboximidamide (PubChem CID 177336801) has the molecular formula C18H19ClF3N5O2 and a molecular weight of 429.83 g/mol. Its IUPAC name is N'-[amino(methoxymethyl)amino]-7-chloro-4-[(2,4-difluorophenyl)methyl]-6-fluoro-2,3-dihydro-1,4-benzoxazine-5-carboximidamide.
| Compound Name | N'-[amino(methoxymethyl)amino]-7-chloro-4-[(2,4-difluorophenyl)methyl]-6-fluoro-2,3-dihydro-1,4-benzoxazine-5-carboximidamide |
|---|---|
| PubChem CID | 177336801 |
| Molecular Formula | C18H19ClF3N5O2 |
| Molecular Weight | 429.83 g/mol |
| Exact Mass | 429.12 |
| IUPAC Name | N'-[amino(methoxymethyl)amino]-7-chloro-4-[(2,4-difluorophenyl)methyl]-6-fluoro-2,3-dihydro-1,4-benzoxazine-5-carboximidamide |
| SMILES | COCN(N)/N=C(\N)c1c(F)c(Cl)cc2c1N(Cc1ccc(F)cc1F)CCO2 |
| InChI | InChI=1S/C18H19ClF3N5O2/c1-28-9-27(24)25-18(23)15-16(22)12(19)7-14-17(15)26(4-5-29-14)8-10-2-3-11(20)6-13(10)21/h2-3,6-7H,4-5,8-9,24H2,1H3,(H2,23,25) |
| InChIKey | PSLCQGDHAWNTOF-UHFFFAOYSA-N |
| XLogP | 2.56 |
| TPSA | 89.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.83 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|