C15H19ClFN5O — CID 177336824
4-(1-bicyclo[1.1.1]pentanylmethyl)-7-chloro-6-fluoro-N'-hydrazinyl-2,3-dihydro-1,4-benzoxazine-5-carboximidamide (PubChem CID 177336824) has the molecular formula C15H19ClFN5O and a molecular weight of 339.80 g/mol. Its IUPAC name is 4-(1-bicyclo[1.1.1]pentanylmethyl)-7-chloro-6-fluoro-N'-hydrazinyl-2,3-dihydro-1,4-benzoxazine-5-carboximidamide.
| Compound Name | 4-(1-bicyclo[1.1.1]pentanylmethyl)-7-chloro-6-fluoro-N'-hydrazinyl-2,3-dihydro-1,4-benzoxazine-5-carboximidamide |
|---|---|
| PubChem CID | 177336824 |
| Molecular Formula | C15H19ClFN5O |
| Molecular Weight | 339.80 g/mol |
| Exact Mass | 339.13 |
| IUPAC Name | 4-(1-bicyclo[1.1.1]pentanylmethyl)-7-chloro-6-fluoro-N'-hydrazinyl-2,3-dihydro-1,4-benzoxazine-5-carboximidamide |
| SMILES | NN/N=C(\N)c1c(F)c(Cl)cc2c1N(CC13CC(C1)C3)CCO2 |
| InChI | InChI=1S/C15H19ClFN5O/c16-9-3-10-13(11(12(9)17)14(18)20-21-19)22(1-2-23-10)7-15-4-8(5-15)6-15/h3,8,21H,1-2,4-7,19H2,(H2,18,20) |
| InChIKey | PNXVBZZMNCPJFT-UHFFFAOYSA-N |
| XLogP | 1.56 |
| TPSA | 88.90 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.80 |
| LogP ≤ 5 | 1.56 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|