C9H10Cl2N2O — CID 82231483
5,7-dichloro-4-methyl-2,3-dihydro-1,4-benzoxazin-6-amine (PubChem CID 82231483) has the molecular formula C9H10Cl2N2O and a molecular weight of 233.10 g/mol. Its IUPAC name is 5,7-dichloro-4-methyl-2,3-dihydro-1,4-benzoxazin-6-amine.
| Compound Name | 5,7-dichloro-4-methyl-2,3-dihydro-1,4-benzoxazin-6-amine |
|---|---|
| PubChem CID | 82231483 |
| Molecular Formula | C9H10Cl2N2O |
| Molecular Weight | 233.10 g/mol |
| Exact Mass | 232.02 |
| IUPAC Name | 5,7-dichloro-4-methyl-2,3-dihydro-1,4-benzoxazin-6-amine |
| SMILES | CN1CCOc2cc(Cl)c(N)c(Cl)c21 |
| InChI | InChI=1S/C9H10Cl2N2O/c1-13-2-3-14-6-4-5(10)8(12)7(11)9(6)13/h4H,2-3,12H2,1H3 |
| InChIKey | DCEBAAMFUXBDLY-UHFFFAOYSA-N |
| XLogP | 2.40 |
| TPSA | 38.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 233.10 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|