C11H15N3O4 — CID 177352307
1-(5-amino-4-methyl-7-nitro-2,3-dihydro-1,4-benzoxazin-6-yl)ethanol (PubChem CID 177352307) has the molecular formula C11H15N3O4 and a molecular weight of 253.26 g/mol. Its IUPAC name is 1-(5-amino-4-methyl-7-nitro-2,3-dihydro-1,4-benzoxazin-6-yl)ethanol.
| Compound Name | 1-(5-amino-4-methyl-7-nitro-2,3-dihydro-1,4-benzoxazin-6-yl)ethanol |
|---|---|
| PubChem CID | 177352307 |
| Molecular Formula | C11H15N3O4 |
| Molecular Weight | 253.26 g/mol |
| Exact Mass | 253.11 |
| IUPAC Name | 1-(5-amino-4-methyl-7-nitro-2,3-dihydro-1,4-benzoxazin-6-yl)ethanol |
| SMILES | CC(O)c1c([N+](=O)[O-])cc2c(c1N)N(C)CCO2 |
| InChI | InChI=1S/C11H15N3O4/c1-6(15)9-7(14(16)17)5-8-11(10(9)12)13(2)3-4-18-8/h5-6,15H,3-4,12H2,1-2H3 |
| InChIKey | NWQYIGDPPXTVDG-UHFFFAOYSA-N |
| XLogP | 1.06 |
| TPSA | 101.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.26 |
| LogP ≤ 5 | 1.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|