About 4-methyl-2,3-dihydrothieno[3,2-b][1,4]oxazin-6-amine
4-methyl-2,3-dihydrothieno[3,2-b][1,4]oxazin-6-amine (PubChem CID 98774331) has the molecular formula C7H10N2OS
and a molecular weight of 170.24 g/mol. Its IUPAC name is 4-methyl-2,3-dihydrothieno[3,2-b][1,4]oxazin-6-amine.
Analyze 4-methyl-2,3-dihydrothieno[3,2-b][1,4]oxazin-6-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-methyl-2,3-dihydrothieno[3,2-b][1,4]oxazin-6-amine?
The IUPAC name of 4-methyl-2,3-dihydrothieno[3,2-b][1,4]oxazin-6-amine (CID 98774331) is 4-methyl-2,3-dihydrothieno[3,2-b][1,4]oxazin-6-amine.
What is the SMILES notation for 4-methyl-2,3-dihydrothieno[3,2-b][1,4]oxazin-6-amine?
The canonical SMILES for 4-methyl-2,3-dihydrothieno[3,2-b][1,4]oxazin-6-amine is CN1CCOc2cc(N)sc21.
What is the InChIKey of 4-methyl-2,3-dihydrothieno[3,2-b][1,4]oxazin-6-amine?
The InChIKey is NCSSEPLMXCBLAB-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H10N2OS/c1-9-2-3-10-5-4-6(8)11-7(5)9/h4H,2-3,8H2,1H3.
What are the key properties of 4-methyl-2,3-dihydrothieno[3,2-b][1,4]oxazin-6-amine?
4-methyl-2,3-dihydrothieno[3,2-b][1,4]oxazin-6-amine has a molecular weight of 170.24 g/mol, XLogP of 1.16, 0 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-methyl-2,3-dihydrothieno[3,2-b][1,4]oxazin-6-amine is sourced from PubChem (CID 98774331), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).