C13H11ClFNO2S — CID 177336845
5-(3-chloro-2-fluoro-5,6,7,8-tetrahydronaphthalen-1-yl)-1,3-thiazolidine-2,4-dione (PubChem CID 177336845) has the molecular formula C13H11ClFNO2S and a molecular weight of 299.75 g/mol. Its IUPAC name is 5-(3-chloro-2-fluoro-5,6,7,8-tetrahydronaphthalen-1-yl)-1,3-thiazolidine-2,4-dione.
| Compound Name | 5-(3-chloro-2-fluoro-5,6,7,8-tetrahydronaphthalen-1-yl)-1,3-thiazolidine-2,4-dione |
|---|---|
| PubChem CID | 177336845 |
| Molecular Formula | C13H11ClFNO2S |
| Molecular Weight | 299.75 g/mol |
| Exact Mass | 299.02 |
| IUPAC Name | 5-(3-chloro-2-fluoro-5,6,7,8-tetrahydronaphthalen-1-yl)-1,3-thiazolidine-2,4-dione |
| SMILES | O=C1NC(=O)C(c2c(F)c(Cl)cc3c2CCCC3)S1 |
| InChI | InChI=1S/C13H11ClFNO2S/c14-8-5-6-3-1-2-4-7(6)9(10(8)15)11-12(17)16-13(18)19-11/h5,11H,1-4H2,(H,16,17,18) |
| InChIKey | NCFXMTHKLYAWAU-UHFFFAOYSA-N |
| XLogP | 3.38 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.75 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|