C20H27FN4O5 — CID 177348944
tert-butyl 3-[[(Z)-4-amino-3-(2-fluoro-3-nitrophenyl)-1-oxobut-3-en-2-ylidene]amino]azetidine-1-carboxylate;ethane (PubChem CID 177348944) has the molecular formula C20H27FN4O5 and a molecular weight of 422.46 g/mol. Its IUPAC name is tert-butyl 3-[[(Z)-4-amino-3-(2-fluoro-3-nitrophenyl)-1-oxobut-3-en-2-ylidene]amino]azetidine-1-carboxylate;ethane.
| Compound Name | tert-butyl 3-[[(Z)-4-amino-3-(2-fluoro-3-nitrophenyl)-1-oxobut-3-en-2-ylidene]amino]azetidine-1-carboxylate;ethane |
|---|---|
| PubChem CID | 177348944 |
| Molecular Formula | C20H27FN4O5 |
| Molecular Weight | 422.46 g/mol |
| Exact Mass | 422.20 |
| IUPAC Name | tert-butyl 3-[[(Z)-4-amino-3-(2-fluoro-3-nitrophenyl)-1-oxobut-3-en-2-ylidene]amino]azetidine-1-carboxylate;ethane |
| SMILES | CC.CC(C)(C)OC(=O)N1CC(/N=C(C=O)/C(=C\N)c2cccc([N+](=O)[O-])c2F)C1 |
| InChI | InChI=1S/C18H21FN4O5.C2H6/c1-18(2,3)28-17(25)22-8-11(9-22)21-14(10-24)13(7-20)12-5-4-6-15(16(12)19)23(26)27;1-2/h4-7,10-11H,8-9,20H2,1-3H3;1-2H3/b13-7-,21-14+; |
| InChIKey | RQEMKMXXASCPCP-FOKHTECUSA-N |
| XLogP | 3.32 |
| TPSA | 128.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.46 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|