C23H23ClN6OS — CID 177349019
N-[[4-(2-amino-1H-imidazol-5-yl)phenyl]methyl]-2-[6-(4-chlorophenyl)-3-pyridinyl]acetamide;thiohydroxylamine (PubChem CID 177349019) has the molecular formula C23H23ClN6OS and a molecular weight of 467.00 g/mol. Its IUPAC name is N-[[4-(2-amino-1H-imidazol-5-yl)phenyl]methyl]-2-[6-(4-chlorophenyl)-3-pyridinyl]acetamide;thiohydroxylamine.
| Compound Name | N-[[4-(2-amino-1H-imidazol-5-yl)phenyl]methyl]-2-[6-(4-chlorophenyl)-3-pyridinyl]acetamide;thiohydroxylamine |
|---|---|
| PubChem CID | 177349019 |
| Molecular Formula | C23H23ClN6OS |
| Molecular Weight | 467.00 g/mol |
| Exact Mass | 466.13 |
| IUPAC Name | N-[[4-(2-amino-1H-imidazol-5-yl)phenyl]methyl]-2-[6-(4-chlorophenyl)-3-pyridinyl]acetamide;thiohydroxylamine |
| SMILES | NS.Nc1ncc(-c2ccc(CNC(=O)Cc3ccc(-c4ccc(Cl)cc4)nc3)cc2)[nH]1 |
| InChI | InChI=1S/C23H20ClN5O.H3NS/c24-19-8-6-17(7-9-19)20-10-3-16(13-26-20)11-22(30)27-12-15-1-4-18(5-2-15)21-14-28-23(25)29-21;1-2/h1-10,13-14H,11-12H2,(H,27,30)(H3,25,28,29);2H,1H2 |
| InChIKey | MUAMZCDQSWFYJL-UHFFFAOYSA-N |
| XLogP | 4.02 |
| TPSA | 122.71 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.00 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|