C23H29N5O2S — CID 177349308
N-[[4-(2-amino-1H-imidazol-5-yl)phenyl]methyl]-2-[4-(oxan-4-yl)phenyl]acetamide;thiohydroxylamine (PubChem CID 177349308) has the molecular formula C23H29N5O2S and a molecular weight of 439.59 g/mol. Its IUPAC name is N-[[4-(2-amino-1H-imidazol-5-yl)phenyl]methyl]-2-[4-(oxan-4-yl)phenyl]acetamide;thiohydroxylamine.
| Compound Name | N-[[4-(2-amino-1H-imidazol-5-yl)phenyl]methyl]-2-[4-(oxan-4-yl)phenyl]acetamide;thiohydroxylamine |
|---|---|
| PubChem CID | 177349308 |
| Molecular Formula | C23H29N5O2S |
| Molecular Weight | 439.59 g/mol |
| Exact Mass | 439.20 |
| IUPAC Name | N-[[4-(2-amino-1H-imidazol-5-yl)phenyl]methyl]-2-[4-(oxan-4-yl)phenyl]acetamide;thiohydroxylamine |
| SMILES | NS.Nc1ncc(-c2ccc(CNC(=O)Cc3ccc(C4CCOCC4)cc3)cc2)[nH]1 |
| InChI | InChI=1S/C23H26N4O2.H3NS/c24-23-26-15-21(27-23)20-7-3-17(4-8-20)14-25-22(28)13-16-1-5-18(6-2-16)19-9-11-29-12-10-19;1-2/h1-8,15,19H,9-14H2,(H,25,28)(H3,24,26,27);2H,1H2 |
| InChIKey | YQDUNFSGMJOPOY-UHFFFAOYSA-N |
| XLogP | 3.20 |
| TPSA | 119.05 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.59 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|