C16H22N4O2 — CID 177349072
(1R)-3-[(R)-[[4-(2-amino-1H-imidazol-5-yl)phenyl]methylamino]-hydroxymethyl]cyclopentan-1-ol (PubChem CID 177349072) has the molecular formula C16H22N4O2 and a molecular weight of 302.38 g/mol. Its IUPAC name is (1R)-3-[(R)-[[4-(2-amino-1H-imidazol-5-yl)phenyl]methylamino]-hydroxymethyl]cyclopentan-1-ol.
| Compound Name | (1R)-3-[(R)-[[4-(2-amino-1H-imidazol-5-yl)phenyl]methylamino]-hydroxymethyl]cyclopentan-1-ol |
|---|---|
| PubChem CID | 177349072 |
| Molecular Formula | C16H22N4O2 |
| Molecular Weight | 302.38 g/mol |
| Exact Mass | 302.17 |
| IUPAC Name | (1R)-3-[(R)-[[4-(2-amino-1H-imidazol-5-yl)phenyl]methylamino]-hydroxymethyl]cyclopentan-1-ol |
| SMILES | Nc1ncc(-c2ccc(CN[C@H](O)C3CC[C@@H](O)C3)cc2)[nH]1 |
| InChI | InChI=1S/C16H22N4O2/c17-16-19-9-14(20-16)11-3-1-10(2-4-11)8-18-15(22)12-5-6-13(21)7-12/h1-4,9,12-13,15,18,21-22H,5-8H2,(H3,17,19,20)/t12?,13-,15-/m1/s1 |
| InChIKey | MDLPLGJHZABPSZ-JYRZLJSNSA-N |
| XLogP | 1.23 |
| TPSA | 107.19 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.38 |
| LogP ≤ 5 | 1.23 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|