C26H29N5OS — CID 177349139
N-[[4-(2-amino-1H-imidazol-5-yl)phenyl]methyl]-2-[4-(3,5-dimethylphenyl)phenyl]acetamide;thiohydroxylamine (PubChem CID 177349139) has the molecular formula C26H29N5OS and a molecular weight of 459.62 g/mol. Its IUPAC name is N-[[4-(2-amino-1H-imidazol-5-yl)phenyl]methyl]-2-[4-(3,5-dimethylphenyl)phenyl]acetamide;thiohydroxylamine.
| Compound Name | N-[[4-(2-amino-1H-imidazol-5-yl)phenyl]methyl]-2-[4-(3,5-dimethylphenyl)phenyl]acetamide;thiohydroxylamine |
|---|---|
| PubChem CID | 177349139 |
| Molecular Formula | C26H29N5OS |
| Molecular Weight | 459.62 g/mol |
| Exact Mass | 459.21 |
| IUPAC Name | N-[[4-(2-amino-1H-imidazol-5-yl)phenyl]methyl]-2-[4-(3,5-dimethylphenyl)phenyl]acetamide;thiohydroxylamine |
| SMILES | Cc1cc(C)cc(-c2ccc(CC(=O)NCc3ccc(-c4cnc(N)[nH]4)cc3)cc2)c1.NS |
| InChI | InChI=1S/C26H26N4O.H3NS/c1-17-11-18(2)13-23(12-17)21-7-3-19(4-8-21)14-25(31)28-15-20-5-9-22(10-6-20)24-16-29-26(27)30-24;1-2/h3-13,16H,14-15H2,1-2H3,(H,28,31)(H3,27,29,30);2H,1H2 |
| InChIKey | OLOPVNOWTUQJJL-UHFFFAOYSA-N |
| XLogP | 4.59 |
| TPSA | 109.82 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.62 |
| LogP ≤ 5 | 4.59 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|