C23H27N7O5S — CID 177349164
N-[[4-(2-nitro-1H-imidazol-5-yl)phenyl]methyl]-2-[6-(piperidin-4-ylmethylsulfonylamino)-3-pyridinyl]acetamide (PubChem CID 177349164) has the molecular formula C23H27N7O5S and a molecular weight of 513.58 g/mol. Its IUPAC name is N-[[4-(2-nitro-1H-imidazol-5-yl)phenyl]methyl]-2-[6-(piperidin-4-ylmethylsulfonylamino)-3-pyridinyl]acetamide.
| Compound Name | N-[[4-(2-nitro-1H-imidazol-5-yl)phenyl]methyl]-2-[6-(piperidin-4-ylmethylsulfonylamino)-3-pyridinyl]acetamide |
|---|---|
| PubChem CID | 177349164 |
| Molecular Formula | C23H27N7O5S |
| Molecular Weight | 513.58 g/mol |
| Exact Mass | 513.18 |
| IUPAC Name | N-[[4-(2-nitro-1H-imidazol-5-yl)phenyl]methyl]-2-[6-(piperidin-4-ylmethylsulfonylamino)-3-pyridinyl]acetamide |
| SMILES | O=C(Cc1ccc(NS(=O)(=O)CC2CCNCC2)nc1)NCc1ccc(-c2cnc([N+](=O)[O-])[nH]2)cc1 |
| InChI | InChI=1S/C23H27N7O5S/c31-22(26-12-16-1-4-19(5-2-16)20-14-27-23(28-20)30(32)33)11-18-3-6-21(25-13-18)29-36(34,35)15-17-7-9-24-10-8-17/h1-6,13-14,17,24H,7-12,15H2,(H,25,29)(H,26,31)(H,27,28) |
| InChIKey | FAZMLKPMUVWQLO-UHFFFAOYSA-N |
| XLogP | 1.98 |
| TPSA | 172.01 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 513.58 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|