C24H28F3N3O3 — CID 177352148
N-[(2,4-difluorophenyl)methyl]formamide;ethylcyclohexane;6-fluoro-1H-quinazoline-2,4-dione (PubChem CID 177352148) has the molecular formula C24H28F3N3O3 and a molecular weight of 463.50 g/mol. Its IUPAC name is N-[(2,4-difluorophenyl)methyl]formamide;ethylcyclohexane;6-fluoro-1H-quinazoline-2,4-dione.
| Compound Name | N-[(2,4-difluorophenyl)methyl]formamide;ethylcyclohexane;6-fluoro-1H-quinazoline-2,4-dione |
|---|---|
| PubChem CID | 177352148 |
| Molecular Formula | C24H28F3N3O3 |
| Molecular Weight | 463.50 g/mol |
| Exact Mass | 463.21 |
| IUPAC Name | N-[(2,4-difluorophenyl)methyl]formamide;ethylcyclohexane;6-fluoro-1H-quinazoline-2,4-dione |
| SMILES | CCC1CCCCC1.O=CNCc1ccc(F)cc1F.O=c1[nH]c(=O)c2cc(F)ccc2[nH]1 |
| InChI | InChI=1S/C8H7F2NO.C8H5FN2O2.C8H16/c9-7-2-1-6(4-11-5-12)8(10)3-7;9-4-1-2-6-5(3-4)7(12)11-8(13)10-6;1-2-8-6-4-3-5-7-8/h1-3,5H,4H2,(H,11,12);1-3H,(H2,10,11,12,13);8H,2-7H2,1H3 |
| InChIKey | VSUJUSHFNIXIFN-UHFFFAOYSA-N |
| XLogP | 4.54 |
| TPSA | 94.82 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.50 |
| LogP ≤ 5 | 4.54 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|