C27H37FN2O4 — CID 177352398
1-[5-(4-fluorophenyl)-2-nitrophenyl]ethyl N,N-dihexylcarbamate (PubChem CID 177352398) has the molecular formula C27H37FN2O4 and a molecular weight of 472.60 g/mol. Its IUPAC name is 1-[5-(4-fluorophenyl)-2-nitrophenyl]ethyl N,N-dihexylcarbamate.
| Compound Name | 1-[5-(4-fluorophenyl)-2-nitrophenyl]ethyl N,N-dihexylcarbamate |
|---|---|
| PubChem CID | 177352398 |
| Molecular Formula | C27H37FN2O4 |
| Molecular Weight | 472.60 g/mol |
| Exact Mass | 472.27 |
| IUPAC Name | 1-[5-(4-fluorophenyl)-2-nitrophenyl]ethyl N,N-dihexylcarbamate |
| SMILES | CCCCCCN(CCCCCC)C(=O)OC(C)c1cc(-c2ccc(F)cc2)ccc1[N+](=O)[O-] |
| InChI | InChI=1S/C27H37FN2O4/c1-4-6-8-10-18-29(19-11-9-7-5-2)27(31)34-21(3)25-20-23(14-17-26(25)30(32)33)22-12-15-24(28)16-13-22/h12-17,20-21H,4-11,18-19H2,1-3H3 |
| InChIKey | GECHNXIPAIMMNM-UHFFFAOYSA-N |
| XLogP | 8.06 |
| TPSA | 72.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.60 |
| LogP ≤ 5 | 8.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|