C30H46N2O4Si — CID 177352415
1-[2-nitro-5-(4-trimethylsilylphenyl)phenyl]ethyl N,N-dihexylcarbamate (PubChem CID 177352415) has the molecular formula C30H46N2O4Si and a molecular weight of 526.79 g/mol. Its IUPAC name is 1-[2-nitro-5-(4-trimethylsilylphenyl)phenyl]ethyl N,N-dihexylcarbamate.
| Compound Name | 1-[2-nitro-5-(4-trimethylsilylphenyl)phenyl]ethyl N,N-dihexylcarbamate |
|---|---|
| PubChem CID | 177352415 |
| Molecular Formula | C30H46N2O4Si |
| Molecular Weight | 526.79 g/mol |
| Exact Mass | 526.32 |
| IUPAC Name | 1-[2-nitro-5-(4-trimethylsilylphenyl)phenyl]ethyl N,N-dihexylcarbamate |
| SMILES | CCCCCCN(CCCCCC)C(=O)OC(C)c1cc(-c2ccc([Si](C)(C)C)cc2)ccc1[N+](=O)[O-] |
| InChI | InChI=1S/C30H46N2O4Si/c1-7-9-11-13-21-31(22-14-12-10-8-2)30(33)36-24(3)28-23-26(17-20-29(28)32(34)35)25-15-18-27(19-16-25)37(4,5)6/h15-20,23-24H,7-14,21-22H2,1-6H3 |
| InChIKey | KSUDMMSUURGJAV-UHFFFAOYSA-N |
| XLogP | 8.47 |
| TPSA | 72.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 526.79 |
| LogP ≤ 5 | 8.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|